C16H21ClN8O — CID 68645023
2-[[7-[(3-amino-4-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]-3-methylbutan-1-ol (PubChem CID 68645023) has the molecular formula C16H21ClN8O and a molecular weight of 376.85 g/mol. Its IUPAC name is 2-[[7-[(3-amino-4-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]-3-methylbutan-1-ol.
| Compound Name | 2-[[7-[(3-amino-4-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 68645023 |
| Molecular Formula | C16H21ClN8O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[[7-[(3-amino-4-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)C(CO)Nc1nc(NCc2ccc(Cl)c(N)c2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C16H21ClN8O/c1-8(2)12(7-26)20-16-21-14(13-15(22-16)24-25-23-13)19-6-9-3-4-10(17)11(18)5-9/h3-5,8,12,26H,6-7,18H2,1-2H3,(H3,19,20,21,22,23,24,25) |
| InChIKey | UVFMWIZIVBHPHD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|