C22H37NO — CID 68645784
N,N-ditert-butyl-6-(4-ethenylphenoxy)hexan-1-amine (PubChem CID 68645784) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is N,N-ditert-butyl-6-(4-ethenylphenoxy)hexan-1-amine.
| Compound Name | N,N-ditert-butyl-6-(4-ethenylphenoxy)hexan-1-amine |
|---|---|
| PubChem CID | 68645784 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | N,N-ditert-butyl-6-(4-ethenylphenoxy)hexan-1-amine |
| SMILES | C=Cc1ccc(OCCCCCCN(C(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H37NO/c1-8-19-13-15-20(16-14-19)24-18-12-10-9-11-17-23(21(2,3)4)22(5,6)7/h8,13-16H,1,9-12,17-18H2,2-7H3 |
| InChIKey | RRCDAXJXAFGJRU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|