C16H31N5O — CID 68646735
2-[(3S)-3-aminopyrrolidin-1-yl]-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethanone (PubChem CID 68646735) has the molecular formula C16H31N5O and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-[(3S)-3-aminopyrrolidin-1-yl]-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3S)-3-aminopyrrolidin-1-yl]-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 68646735 |
| Molecular Formula | C16H31N5O |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 2-[(3S)-3-aminopyrrolidin-1-yl]-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]ethanone |
| SMILES | CN1CCC(N2CCN(C(=O)CN3CC[C@H](N)C3)CC2)CC1 |
| InChI | InChI=1S/C16H31N5O/c1-18-5-3-15(4-6-18)20-8-10-21(11-9-20)16(22)13-19-7-2-14(17)12-19/h14-15H,2-13,17H2,1H3/t14-/m0/s1 |
| InChIKey | NYSDOGSZVOKXBE-AWEZNQCLSA-N |
| XLogP | -0.74 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |