C20H32N6 — CID 68648517
3-hex-1-enyl-N-[3-(4-methylpiperazin-1-yl)propyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 68648517) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 3-hex-1-enyl-N-[3-(4-methylpiperazin-1-yl)propyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-hex-1-enyl-N-[3-(4-methylpiperazin-1-yl)propyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 68648517 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 3-hex-1-enyl-N-[3-(4-methylpiperazin-1-yl)propyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCCCC=Cc1cnc2ccc(NCCCN3CCN(C)CC3)nn12 |
| InChI | InChI=1S/C20H32N6/c1-3-4-5-6-8-18-17-22-20-10-9-19(23-26(18)20)21-11-7-12-25-15-13-24(2)14-16-25/h6,8-10,17H,3-5,7,11-16H2,1-2H3,(H,21,23) |
| InChIKey | CULWKHCMXTVQBM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|