C5H6N2O2S — CID 686488
methyl N-(1,3-thiazol-2-yl)carbamate (PubChem CID 686488) has the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. Its IUPAC name is methyl N-(1,3-thiazol-2-yl)carbamate.
| Compound Name | methyl N-(1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 686488 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | methyl N-(1,3-thiazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1nccs1 |
| InChI | InChI=1S/C5H6N2O2S/c1-9-5(8)7-4-6-2-3-10-4/h2-3H,1H3,(H,6,7,8) |
| InChIKey | NAFBIYLNNXZOFN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |