C27H24N4O2 — CID 68650974
3-[5-amino-6-[2-(4-methylphenyl)acetyl]pyrazin-2-yl]-N-benzylbenzamide (PubChem CID 68650974) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[5-amino-6-[2-(4-methylphenyl)acetyl]pyrazin-2-yl]-N-benzylbenzamide.
| Compound Name | 3-[5-amino-6-[2-(4-methylphenyl)acetyl]pyrazin-2-yl]-N-benzylbenzamide |
|---|---|
| PubChem CID | 68650974 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-[5-amino-6-[2-(4-methylphenyl)acetyl]pyrazin-2-yl]-N-benzylbenzamide |
| SMILES | Cc1ccc(CC(=O)c2nc(-c3cccc(C(=O)NCc4ccccc4)c3)cnc2N)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-18-10-12-19(13-11-18)14-24(32)25-26(28)29-17-23(31-25)21-8-5-9-22(15-21)27(33)30-16-20-6-3-2-4-7-20/h2-13,15,17H,14,16H2,1H3,(H2,28,29)(H,30,33) |
| InChIKey | BMKMZCQHBDQYIE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |