C22H23N7O — CID 68651901
3-[5-amino-6-[N'-(methylamino)carbamimidoyl]pyrazin-2-yl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 68651901) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[5-amino-6-[N'-(methylamino)carbamimidoyl]pyrazin-2-yl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 3-[5-amino-6-[N'-(methylamino)carbamimidoyl]pyrazin-2-yl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 68651901 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-[5-amino-6-[N'-(methylamino)carbamimidoyl]pyrazin-2-yl]-N-[(1S)-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | CNN=C(N)c1nc(-c2cccc(C(=O)N[C@H]3CCc4ccccc43)c2)cnc1N |
| InChI | InChI=1S/C22H23N7O/c1-25-29-21(24)19-20(23)26-12-18(27-19)14-6-4-7-15(11-14)22(30)28-17-10-9-13-5-2-3-8-16(13)17/h2-8,11-12,17,25H,9-10H2,1H3,(H2,23,26)(H2,24,29)(H,28,30)/t17-/m0/s1 |
| InChIKey | FREHRHOCTONBAH-KRWDZBQOSA-N |
| XLogP | 1.98 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|