C10H16N2O4S — CID 68653266
(2S,4S)-4-amino-4-(2-methylsulfonyl-4-pyridinyl)butane-1,2-diol (PubChem CID 68653266) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is (2S,4S)-4-amino-4-(2-methylsulfonyl-4-pyridinyl)butane-1,2-diol.
| Compound Name | (2S,4S)-4-amino-4-(2-methylsulfonyl-4-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 68653266 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (2S,4S)-4-amino-4-(2-methylsulfonyl-4-pyridinyl)butane-1,2-diol |
| SMILES | CS(=O)(=O)c1cc([C@@H](N)C[C@H](O)CO)ccn1 |
| InChI | InChI=1S/C10H16N2O4S/c1-17(15,16)10-4-7(2-3-12-10)9(11)5-8(14)6-13/h2-4,8-9,13-14H,5-6,11H2,1H3/t8-,9-/m0/s1 |
| InChIKey | ZHFJUAGCADSGMQ-IUCAKERBSA-N |
| XLogP | -0.77 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |