C14H21NO3 — CID 68653363
3-amino-3-(2,4-dimethoxyphenyl)hex-5-en-1-ol (PubChem CID 68653363) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-amino-3-(2,4-dimethoxyphenyl)hex-5-en-1-ol.
| Compound Name | 3-amino-3-(2,4-dimethoxyphenyl)hex-5-en-1-ol |
|---|---|
| PubChem CID | 68653363 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-amino-3-(2,4-dimethoxyphenyl)hex-5-en-1-ol |
| SMILES | C=CCC(N)(CCO)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H21NO3/c1-4-7-14(15,8-9-16)12-6-5-11(17-2)10-13(12)18-3/h4-6,10,16H,1,7-9,15H2,2-3H3 |
| InChIKey | DHJAPHVTNUOBFN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|