C19H22N4O4 — CID 68654838
4-[3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]morpholine (PubChem CID 68654838) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]morpholine.
| Compound Name | 4-[3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]morpholine |
|---|---|
| PubChem CID | 68654838 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-[3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]morpholine |
| SMILES | COc1cc(-c2cnc3c(N4CCOCC4)nccn23)cc(OC)c1OC |
| InChI | InChI=1S/C19H22N4O4/c1-24-15-10-13(11-16(25-2)17(15)26-3)14-12-21-19-18(20-4-5-23(14)19)22-6-8-27-9-7-22/h4-5,10-12H,6-9H2,1-3H3 |
| InChIKey | XUVQDOKJUZEZAL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |