C27H45N5O10 — CID 68658427
methyl 2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]acetate (PubChem CID 68658427) has the molecular formula C27H45N5O10 and a molecular weight of 599.68 g/mol. Its IUPAC name is methyl 2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 68658427 |
| Molecular Formula | C27H45N5O10 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | methyl 2-[[(6S,12S,16E)-9,9-dimethyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-5,8,11-trioxo-6-propan-2-yl-1,14-dioxa-4,7,10-triazacyclooctadec-16-ene-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C1CNC(=O)[C@H](C(C)C)NC(=O)C(C)(C)NC(=O)[C@@H](NC(=O)OC(C)(C)C)COC/C=C/CO1 |
| InChI | InChI=1S/C27H45N5O10/c1-16(2)20-23(36)28-13-18(22(35)29-14-19(33)39-8)41-12-10-9-11-40-15-17(30-25(38)42-26(3,4)5)21(34)32-27(6,7)24(37)31-20/h9-10,16-18,20H,11-15H2,1-8H3,(H,28,36)(H,29,35)(H,30,38)(H,31,37)(H,32,34)/b10-9+/t17-,18?,20-/m0/s1 |
| InChIKey | LGJSIHBDHHTBKI-YNCZRYBYSA-N |
| XLogP | -0.71 |
| TPSA | 199.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|