C25H24N2O5 — CID 68661421
methyl 3-[[6-(3-methoxy-4-methylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoate (PubChem CID 68661421) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 3-[[6-(3-methoxy-4-methylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoate.
| Compound Name | methyl 3-[[6-(3-methoxy-4-methylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 68661421 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl 3-[[6-(3-methoxy-4-methylphenoxy)-1-methylbenzimidazol-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCc2nc3ccc(Oc4ccc(C)c(OC)c4)cc3n2C)c1 |
| InChI | InChI=1S/C25H24N2O5/c1-16-8-9-20(14-23(16)29-3)32-19-10-11-21-22(13-19)27(2)24(26-21)15-31-18-7-5-6-17(12-18)25(28)30-4/h5-14H,15H2,1-4H3 |
| InChIKey | BPJVBTZGZVSYGB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |