C25H24N2O4 — CID 68970988
methyl 2-methyl-3-[[1-methyl-6-(3-methylphenoxy)benzimidazol-2-yl]methoxy]benzoate (PubChem CID 68970988) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 2-methyl-3-[[1-methyl-6-(3-methylphenoxy)benzimidazol-2-yl]methoxy]benzoate.
| Compound Name | methyl 2-methyl-3-[[1-methyl-6-(3-methylphenoxy)benzimidazol-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 68970988 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl 2-methyl-3-[[1-methyl-6-(3-methylphenoxy)benzimidazol-2-yl]methoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCc2nc3ccc(Oc4cccc(C)c4)cc3n2C)c1C |
| InChI | InChI=1S/C25H24N2O4/c1-16-7-5-8-18(13-16)31-19-11-12-21-22(14-19)27(3)24(26-21)15-30-23-10-6-9-20(17(23)2)25(28)29-4/h5-14H,15H2,1-4H3 |
| InChIKey | FTTBUFHNWCLJJB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |