C8H9F4N3O2 — CID 68662138
(2-fluoro-3-pyridinyl)methylhydrazine;2,2,2-trifluoroacetic acid (PubChem CID 68662138) has the molecular formula C8H9F4N3O2 and a molecular weight of 255.17 g/mol. Its IUPAC name is (2-fluoro-3-pyridinyl)methylhydrazine;2,2,2-trifluoroacetic acid.
| Compound Name | (2-fluoro-3-pyridinyl)methylhydrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68662138 |
| Molecular Formula | C8H9F4N3O2 |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (2-fluoro-3-pyridinyl)methylhydrazine;2,2,2-trifluoroacetic acid |
| SMILES | NNCc1cccnc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H8FN3.C2HF3O2/c7-6-5(4-10-8)2-1-3-9-6;3-2(4,5)1(6)7/h1-3,10H,4,8H2;(H,6,7) |
| InChIKey | UJSQOKQGZFLGJP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|