C27H32N4O3 — CID 68662785
5-[(2R)-2-benzylpiperazine-1-carbonyl]-3-(2-hydroxycyclohexyl)-4-phenyl-1H-imidazol-2-one (PubChem CID 68662785) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 5-[(2R)-2-benzylpiperazine-1-carbonyl]-3-(2-hydroxycyclohexyl)-4-phenyl-1H-imidazol-2-one.
| Compound Name | 5-[(2R)-2-benzylpiperazine-1-carbonyl]-3-(2-hydroxycyclohexyl)-4-phenyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 68662785 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 5-[(2R)-2-benzylpiperazine-1-carbonyl]-3-(2-hydroxycyclohexyl)-4-phenyl-1H-imidazol-2-one |
| SMILES | O=C(c1[nH]c(=O)n(C2CCCCC2O)c1-c1ccccc1)N1CCNC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H32N4O3/c32-23-14-8-7-13-22(23)31-25(20-11-5-2-6-12-20)24(29-27(31)34)26(33)30-16-15-28-18-21(30)17-19-9-3-1-4-10-19/h1-6,9-12,21-23,28,32H,7-8,13-18H2,(H,29,34)/t21-,22?,23?/m1/s1 |
| InChIKey | VXUNSCXRZQLBLG-DDRJZQQSSA-N |
| XLogP | 2.98 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |