C36H26F5N5O6 — CID 68666480
[1-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]naphthalen-2-yl] 2,2,2-trifluoroacetate (PubChem CID 68666480) has the molecular formula C36H26F5N5O6 and a molecular weight of 719.62 g/mol. Its IUPAC name is [1-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]naphthalen-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]naphthalen-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68666480 |
| Molecular Formula | C36H26F5N5O6 |
| Molecular Weight | 719.62 g/mol |
| Exact Mass | 719.18 |
| IUPAC Name | [1-[[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylphenyl]carbamoyl]naphthalen-2-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(NC(=O)c2c(OC(=O)C(F)(F)F)ccc3ccccc23)cc1-c1nc(NC(CO)CO)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C36H26F5N5O6/c1-18-9-11-20(42-33(50)29-22-6-3-2-5-19(22)10-13-27(29)52-34(51)36(39,40)41)15-24(18)30-23-12-14-28(49)46(31-25(37)7-4-8-26(31)38)32(23)45-35(44-30)43-21(16-47)17-48/h2-15,21,47-48H,16-17H2,1H3,(H,42,50)(H,43,44,45) |
| InChIKey | CGIYVTIPQMHGKR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|