C32H29F5N6O8 — CID 87427934
(2,2,2-trifluoroacetyl) 4-[[3-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-3-oxopropyl]amino]-4-oxobutanoate (PubChem CID 87427934) has the molecular formula C32H29F5N6O8 and a molecular weight of 720.61 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[[3-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-3-oxopropyl]amino]-4-oxobutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[[3-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-3-oxopropyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 87427934 |
| Molecular Formula | C32H29F5N6O8 |
| Molecular Weight | 720.61 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[[3-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-3-oxopropyl]amino]-4-oxobutanoate |
| SMILES | Cc1ccc(NC(=O)CCNC(=O)CCC(=O)OC(=O)C(F)(F)F)cc1-c1nc(NC(CO)CO)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C32H29F5N6O8/c1-16-5-6-17(39-24(47)11-12-38-23(46)8-10-26(49)51-30(50)32(35,36)37)13-20(16)27-19-7-9-25(48)43(28-21(33)3-2-4-22(28)34)29(19)42-31(41-27)40-18(14-44)15-45/h2-7,9,13,18,44-45H,8,10-12,14-15H2,1H3,(H,38,46)(H,39,47)(H,40,41,42) |
| InChIKey | CDNWNTVQHNIYEK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 201.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|