C22H24N6 — CID 68666578
1,1-bis(4-benzyl-1H-pyrazol-5-yl)ethane-1,2-diamine (PubChem CID 68666578) has the molecular formula C22H24N6 and a molecular weight of 372.48 g/mol. Its IUPAC name is 1,1-bis(4-benzyl-1H-pyrazol-5-yl)ethane-1,2-diamine.
| Compound Name | 1,1-bis(4-benzyl-1H-pyrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 68666578 |
| Molecular Formula | C22H24N6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1,1-bis(4-benzyl-1H-pyrazol-5-yl)ethane-1,2-diamine |
| SMILES | NCC(N)(c1[nH]ncc1Cc1ccccc1)c1[nH]ncc1Cc1ccccc1 |
| InChI | InChI=1S/C22H24N6/c23-15-22(24,20-18(13-25-27-20)11-16-7-3-1-4-8-16)21-19(14-26-28-21)12-17-9-5-2-6-10-17/h1-10,13-14H,11-12,15,23-24H2,(H,25,27)(H,26,28) |
| InChIKey | XQNXVVMVOLQEHY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |