C19H22N4O — CID 68669237
3-[(5-aminoindazol-1-yl)methyl]-N-tert-butylbenzamide (PubChem CID 68669237) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-[(5-aminoindazol-1-yl)methyl]-N-tert-butylbenzamide.
| Compound Name | 3-[(5-aminoindazol-1-yl)methyl]-N-tert-butylbenzamide |
|---|---|
| PubChem CID | 68669237 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 3-[(5-aminoindazol-1-yl)methyl]-N-tert-butylbenzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(Cn2ncc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C19H22N4O/c1-19(2,3)22-18(24)14-6-4-5-13(9-14)12-23-17-8-7-16(20)10-15(17)11-21-23/h4-11H,12,20H2,1-3H3,(H,22,24) |
| InChIKey | ZNSFNSUPQXYMJN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|