C14H17N5 — CID 68673170
4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine (PubChem CID 68673170) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine.
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine |
|---|---|
| PubChem CID | 68673170 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine |
| SMILES | Cc1nn(C)cc1C1(N)C(N)=CNc2ccccc21 |
| InChI | InChI=1S/C14H17N5/c1-9-11(8-19(2)18-9)14(16)10-5-3-4-6-12(10)17-7-13(14)15/h3-8,17H,15-16H2,1-2H3 |
| InChIKey | DGGIJZAQAOCSIA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |