About 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine
4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine (PubChem CID 68673170) has the molecular formula C14H17N5
and a molecular weight of 255.33 g/mol. Its IUPAC name is 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine.
Molecular Properties
| Compound Name | 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine |
| PubChem CID | 68673170 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine |
| SMILES | Cc1nn(C)cc1C1(N)C(N)=CNc2ccccc21 |
| InChI | InChI=1S/C14H17N5/c1-9-11(8-19(2)18-9)14(16)10-5-3-4-6-12(10)17-7-13(14)15/h3-8,17H,15-16H2,1-2H3 |
| InChIKey | DGGIJZAQAOCSIA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine?
The IUPAC name of 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine (CID 68673170) is 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine.
What is the SMILES notation for 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine?
The canonical SMILES for 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine is Cc1nn(C)cc1C1(N)C(N)=CNc2ccccc21.
What is the InChIKey of 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine?
The InChIKey is DGGIJZAQAOCSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5/c1-9-11(8-19(2)18-9)14(16)10-5-3-4-6-12(10)17-7-13(14)15/h3-8,17H,15-16H2,1-2H3.
What are the key properties of 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine?
4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine has a molecular weight of 255.33 g/mol, XLogP of 1.16, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dimethylpyrazol-4-yl)-1H-quinoline-3,4-diamine is sourced from PubChem (CID 68673170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).