C13H14BrN3O4S — CID 68676144
tert-butyl N-(3-bromo-7-nitrothieno[3,2-c]pyridin-4-yl)-N-methylcarbamate (PubChem CID 68676144) has the molecular formula C13H14BrN3O4S and a molecular weight of 388.24 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-7-nitrothieno[3,2-c]pyridin-4-yl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(3-bromo-7-nitrothieno[3,2-c]pyridin-4-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 68676144 |
| Molecular Formula | C13H14BrN3O4S |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | tert-butyl N-(3-bromo-7-nitrothieno[3,2-c]pyridin-4-yl)-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ncc([N+](=O)[O-])c2scc(Br)c12 |
| InChI | InChI=1S/C13H14BrN3O4S/c1-13(2,3)21-12(18)16(4)11-9-7(14)6-22-10(9)8(5-15-11)17(19)20/h5-6H,1-4H3 |
| InChIKey | GPBHCEJWHQSACP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|