C34H39N5O2 — CID 68678296
[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone (PubChem CID 68678296) has the molecular formula C34H39N5O2 and a molecular weight of 549.72 g/mol. Its IUPAC name is [4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone.
| Compound Name | [4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone |
|---|---|
| PubChem CID | 68678296 |
| Molecular Formula | C34H39N5O2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | [4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone |
| SMILES | Cc1nc2ccccc2n1C1C[C@H]2CC[C@@H](C1)N2CCC1(c2ccccc2)CCN(C(=O)c2cc[n+]([O-])cc2)CC1 |
| InChI | InChI=1S/C34H39N5O2/c1-25-35-31-9-5-6-10-32(31)39(25)30-23-28-11-12-29(24-30)38(28)22-17-34(27-7-3-2-4-8-27)15-20-36(21-16-34)33(40)26-13-18-37(41)19-14-26/h2-10,13-14,18-19,28-30H,11-12,15-17,20-24H2,1H3/t28-,29+,30? |
| InChIKey | KOJKRTSNIWSQIH-BWMKXQIXSA-N |
| XLogP | 5.41 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|