C36H42N6O2 — CID 87538095
N'-hydroxy-3-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidine-1-carbonyl]benzenecarboximidamide (PubChem CID 87538095) has the molecular formula C36H42N6O2 and a molecular weight of 590.77 g/mol. Its IUPAC name is N'-hydroxy-3-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidine-1-carbonyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-3-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidine-1-carbonyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 87538095 |
| Molecular Formula | C36H42N6O2 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | N'-hydroxy-3-[4-[2-[(1R,5S)-3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidine-1-carbonyl]benzenecarboximidamide |
| SMILES | Cc1nc2ccccc2n1C1C[C@H]2CC[C@@H](C1)N2CCC1(c2ccccc2)CCN(C(=O)c2cccc(C(N)=NO)c2)CC1 |
| InChI | InChI=1S/C36H42N6O2/c1-25-38-32-12-5-6-13-33(32)42(25)31-23-29-14-15-30(24-31)41(29)21-18-36(28-10-3-2-4-11-28)16-19-40(20-17-36)35(43)27-9-7-8-26(22-27)34(37)39-44/h2-13,22,29-31,44H,14-21,23-24H2,1H3,(H2,37,39)/t29-,30+,31? |
| InChIKey | HMDUBBHNCCEFMM-BETPUDKTSA-N |
| XLogP | 5.87 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|