C19H25N3O3 — CID 68680571
ethyl 5-[3-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylate (PubChem CID 68680571) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 5-[3-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[3-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 68680571 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | ethyl 5-[3-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C(=O)N3CCCC(N(C)C)C3)ccc2[nH]1 |
| InChI | InChI=1S/C19H25N3O3/c1-4-25-19(24)17-11-14-10-13(7-8-16(14)20-17)18(23)22-9-5-6-15(12-22)21(2)3/h7-8,10-11,15,20H,4-6,9,12H2,1-3H3 |
| InChIKey | WLRBJDQOZXMPJC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |