C17H22ClN3O3 — CID 68683143
5-[4-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylic acid;hydrochloride (PubChem CID 68683143) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 5-[4-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylic acid;hydrochloride.
| Compound Name | 5-[4-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 68683143 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 5-[4-(dimethylamino)piperidine-1-carbonyl]-1H-indole-2-carboxylic acid;hydrochloride |
| SMILES | CN(C)C1CCN(C(=O)c2ccc3[nH]c(C(=O)O)cc3c2)CC1.Cl |
| InChI | InChI=1S/C17H21N3O3.ClH/c1-19(2)13-5-7-20(8-6-13)16(21)11-3-4-14-12(9-11)10-15(18-14)17(22)23;/h3-4,9-10,13,18H,5-8H2,1-2H3,(H,22,23);1H |
| InChIKey | NGVLYTXEDOXURP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |