C29H30FN3O8S — CID 68681642
1-carbamoyl-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-morpholin-4-ylethoxy)-3,4-dihydroisoquinoline-1-carboxylic acid (PubChem CID 68681642) has the molecular formula C29H30FN3O8S and a molecular weight of 599.64 g/mol. Its IUPAC name is 1-carbamoyl-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-morpholin-4-ylethoxy)-3,4-dihydroisoquinoline-1-carboxylic acid.
| Compound Name | 1-carbamoyl-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-morpholin-4-ylethoxy)-3,4-dihydroisoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 68681642 |
| Molecular Formula | C29H30FN3O8S |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | 1-carbamoyl-2-[4-(4-fluorophenoxy)phenyl]sulfonyl-6-(2-morpholin-4-ylethoxy)-3,4-dihydroisoquinoline-1-carboxylic acid |
| SMILES | NC(=O)C1(C(=O)O)c2ccc(OCCN3CCOCC3)cc2CCN1S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H30FN3O8S/c30-21-1-3-22(4-2-21)41-23-5-8-25(9-6-23)42(37,38)33-12-11-20-19-24(40-18-15-32-13-16-39-17-14-32)7-10-26(20)29(33,27(31)34)28(35)36/h1-10,19H,11-18H2,(H2,31,34)(H,35,36) |
| InChIKey | ORHIENCSXXCJGX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 148.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|