C14H18N3O3+ — CID 68682752
ethyl 3-[3-(4-hydroxyphenyl)-3-methyltriazol-3-ium-4-yl]propanoate (PubChem CID 68682752) has the molecular formula C14H18N3O3+ and a molecular weight of 276.32 g/mol. Its IUPAC name is ethyl 3-[3-(4-hydroxyphenyl)-3-methyltriazol-3-ium-4-yl]propanoate.
| Compound Name | ethyl 3-[3-(4-hydroxyphenyl)-3-methyltriazol-3-ium-4-yl]propanoate |
|---|---|
| PubChem CID | 68682752 |
| Molecular Formula | C14H18N3O3+ |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | ethyl 3-[3-(4-hydroxyphenyl)-3-methyltriazol-3-ium-4-yl]propanoate |
| SMILES | CCOC(=O)CCC1=CN=N[N+]1(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H17N3O3/c1-3-20-14(19)9-6-12-10-15-16-17(12,2)11-4-7-13(18)8-5-11/h4-5,7-8,10H,3,6,9H2,1-2H3/p+1 |
| InChIKey | DLISZHWUEYFLIJ-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|