C22H22N2O6 — CID 68683176
5-(hydroxymethyl)-3-[3-[2-(2-methoxyethoxy)phenyl]-1-oxo-2H-isoquinolin-7-yl]-1,3-oxazolidin-2-one (PubChem CID 68683176) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-[3-[2-(2-methoxyethoxy)phenyl]-1-oxo-2H-isoquinolin-7-yl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(hydroxymethyl)-3-[3-[2-(2-methoxyethoxy)phenyl]-1-oxo-2H-isoquinolin-7-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 68683176 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 5-(hydroxymethyl)-3-[3-[2-(2-methoxyethoxy)phenyl]-1-oxo-2H-isoquinolin-7-yl]-1,3-oxazolidin-2-one |
| SMILES | COCCOc1ccccc1-c1cc2ccc(N3CC(CO)OC3=O)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H22N2O6/c1-28-8-9-29-20-5-3-2-4-17(20)19-10-14-6-7-15(11-18(14)21(26)23-19)24-12-16(13-25)30-22(24)27/h2-7,10-11,16,25H,8-9,12-13H2,1H3,(H,23,26) |
| InChIKey | CIPYQYUCNZGOBZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|