C19H29N3 — CID 68688509
(3R,4R)-3-butyl-1-[2-(1H-indol-3-yl)ethyl]piperidin-4-amine (PubChem CID 68688509) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (3R,4R)-3-butyl-1-[2-(1H-indol-3-yl)ethyl]piperidin-4-amine.
| Compound Name | (3R,4R)-3-butyl-1-[2-(1H-indol-3-yl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 68688509 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | (3R,4R)-3-butyl-1-[2-(1H-indol-3-yl)ethyl]piperidin-4-amine |
| SMILES | CCCC[C@@H]1CN(CCc2c[nH]c3ccccc23)CC[C@H]1N |
| InChI | InChI=1S/C19H29N3/c1-2-3-6-16-14-22(12-10-18(16)20)11-9-15-13-21-19-8-5-4-7-17(15)19/h4-5,7-8,13,16,18,21H,2-3,6,9-12,14,20H2,1H3/t16-,18-/m1/s1 |
| InChIKey | QQWVKZWZPIFCEB-SJLPKXTDSA-N |
| XLogP | 3.55 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |