C12H15N3O2 — CID 68689213
N,N-dimethyl-1-(2-methyl-4-nitro-1H-indol-3-yl)methanamine (PubChem CID 68689213) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-methyl-4-nitro-1H-indol-3-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(2-methyl-4-nitro-1H-indol-3-yl)methanamine |
|---|---|
| PubChem CID | 68689213 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N,N-dimethyl-1-(2-methyl-4-nitro-1H-indol-3-yl)methanamine |
| SMILES | Cc1[nH]c2cccc([N+](=O)[O-])c2c1CN(C)C |
| InChI | InChI=1S/C12H15N3O2/c1-8-9(7-14(2)3)12-10(13-8)5-4-6-11(12)15(16)17/h4-6,13H,7H2,1-3H3 |
| InChIKey | GASOVVPLQWXJSG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|