C19H15ClN5O3S- — CID 68702629
2-[3-[3-(4-chlorophenyl)-2-(sulfinatoamino)-4,5-dihydroimidazol-4-yl]phenoxy]pyrazine (PubChem CID 68702629) has the molecular formula C19H15ClN5O3S- and a molecular weight of 428.88 g/mol. Its IUPAC name is 2-[3-[3-(4-chlorophenyl)-2-(sulfinatoamino)-4,5-dihydroimidazol-4-yl]phenoxy]pyrazine.
| Compound Name | 2-[3-[3-(4-chlorophenyl)-2-(sulfinatoamino)-4,5-dihydroimidazol-4-yl]phenoxy]pyrazine |
|---|---|
| PubChem CID | 68702629 |
| Molecular Formula | C19H15ClN5O3S- |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 2-[3-[3-(4-chlorophenyl)-2-(sulfinatoamino)-4,5-dihydroimidazol-4-yl]phenoxy]pyrazine |
| SMILES | O=S([O-])NC1=NCC(c2cccc(Oc3cnccn3)c2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN5O3S/c20-14-4-6-15(7-5-14)25-17(11-23-19(25)24-29(26)27)13-2-1-3-16(10-13)28-18-12-21-8-9-22-18/h1-10,12,17H,11H2,(H,23,24)(H,26,27)/p-1 |
| InChIKey | TVQCLDAZUYYKJR-UHFFFAOYSA-M |
| XLogP | 3.22 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|