C14H19N3O2 — CID 68704538
8-amino-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 68704538) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 8-amino-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-amino-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 68704538 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 8-amino-3-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1cccc2c1NC(=O)C(N1CCC[C@H]1CO)C2 |
| InChI | InChI=1S/C14H19N3O2/c15-11-5-1-3-9-7-12(14(19)16-13(9)11)17-6-2-4-10(17)8-18/h1,3,5,10,12,18H,2,4,6-8,15H2,(H,16,19)/t10-,12?/m0/s1 |
| InChIKey | WFRVWXXTASDATK-NUHJPDEHSA-N |
| XLogP | 0.59 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|