C24H19N3O4 — CID 68705820
4-[(4-benzoylphenyl)methyl]-6-methoxy-2-phenyl-1,2,4-triazine-3,5-dione (PubChem CID 68705820) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 4-[(4-benzoylphenyl)methyl]-6-methoxy-2-phenyl-1,2,4-triazine-3,5-dione.
| Compound Name | 4-[(4-benzoylphenyl)methyl]-6-methoxy-2-phenyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 68705820 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-[(4-benzoylphenyl)methyl]-6-methoxy-2-phenyl-1,2,4-triazine-3,5-dione |
| SMILES | COc1nn(-c2ccccc2)c(=O)n(Cc2ccc(C(=O)c3ccccc3)cc2)c1=O |
| InChI | InChI=1S/C24H19N3O4/c1-31-22-23(29)26(24(30)27(25-22)20-10-6-3-7-11-20)16-17-12-14-19(15-13-17)21(28)18-8-4-2-5-9-18/h2-15H,16H2,1H3 |
| InChIKey | IZOQKQLPMYFVFS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |