C27H44F2N2O3 — CID 68706918
4-[2-[3-[(1S)-1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]-3-(methylamino)propyl]cyclohexan-1-ol (PubChem CID 68706918) has the molecular formula C27H44F2N2O3 and a molecular weight of 482.66 g/mol. Its IUPAC name is 4-[2-[3-[(1S)-1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]-3-(methylamino)propyl]cyclohexan-1-ol.
| Compound Name | 4-[2-[3-[(1S)-1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]-3-(methylamino)propyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 68706918 |
| Molecular Formula | C27H44F2N2O3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | 4-[2-[3-[(1S)-1-(2,3-difluorophenyl)-1-hydroxy-5-methoxypentyl]piperidin-1-yl]-3-(methylamino)propyl]cyclohexan-1-ol |
| SMILES | CNCC(CC1CCC(O)CC1)N1CCCC([C@@](O)(CCCCOC)c2cccc(F)c2F)C1 |
| InChI | InChI=1S/C27H44F2N2O3/c1-30-18-22(17-20-10-12-23(32)13-11-20)31-15-6-7-21(19-31)27(33,14-3-4-16-34-2)24-8-5-9-25(28)26(24)29/h5,8-9,20-23,30,32-33H,3-4,6-7,10-19H2,1-2H3/t20?,21?,22?,23?,27-/m0/s1 |
| InChIKey | BXBBZXYRHPWIGD-PQHRWPICSA-N |
| XLogP | 4.21 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|