C32H54N2O3 — CID 68708354
1-[(3R)-1-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidin-3-yl]-1-(2-cyclopentyloxyphenyl)-5-methoxypentan-1-ol (PubChem CID 68708354) has the molecular formula C32H54N2O3 and a molecular weight of 514.80 g/mol. Its IUPAC name is 1-[(3R)-1-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidin-3-yl]-1-(2-cyclopentyloxyphenyl)-5-methoxypentan-1-ol.
| Compound Name | 1-[(3R)-1-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidin-3-yl]-1-(2-cyclopentyloxyphenyl)-5-methoxypentan-1-ol |
|---|---|
| PubChem CID | 68708354 |
| Molecular Formula | C32H54N2O3 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.41 |
| IUPAC Name | 1-[(3R)-1-[1-cyclohexyl-3-(methylamino)propan-2-yl]piperidin-3-yl]-1-(2-cyclopentyloxyphenyl)-5-methoxypentan-1-ol |
| SMILES | CNCC(CC1CCCCC1)N1CCC[C@@H](C(O)(CCCCOC)c2ccccc2OC2CCCC2)C1 |
| InChI | InChI=1S/C32H54N2O3/c1-33-24-28(23-26-13-4-3-5-14-26)34-21-12-15-27(25-34)32(35,20-10-11-22-36-2)30-18-8-9-19-31(30)37-29-16-6-7-17-29/h8-9,18-19,26-29,33,35H,3-7,10-17,20-25H2,1-2H3/t27-,28?,32?/m1/s1 |
| InChIKey | GSZGIDSJGUODQF-NGFHQYDQSA-N |
| XLogP | 6.28 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|