C17H17N3O3 — CID 6870699
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 6870699) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 6870699 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H17N3O3/c1-20(2)14-6-3-12(4-7-14)10-18-19-17(21)13-5-8-15-16(9-13)23-11-22-15/h3-10H,11H2,1-2H3,(H,19,21)/b18-10+ |
| InChIKey | YOQJEZKIRDCCPQ-VCHYOVAHSA-N |
| XLogP | 2.25 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|