C13H28N2O3Si — CID 68710051
[(2R,3S)-2-amino-3-cyclopentyl-3-trimethylsilyloxypropyl]-methylcarbamic acid (PubChem CID 68710051) has the molecular formula C13H28N2O3Si and a molecular weight of 288.46 g/mol. Its IUPAC name is [(2R,3S)-2-amino-3-cyclopentyl-3-trimethylsilyloxypropyl]-methylcarbamic acid.
| Compound Name | [(2R,3S)-2-amino-3-cyclopentyl-3-trimethylsilyloxypropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 68710051 |
| Molecular Formula | C13H28N2O3Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(2R,3S)-2-amino-3-cyclopentyl-3-trimethylsilyloxypropyl]-methylcarbamic acid |
| SMILES | CN(C[C@@H](N)[C@@H](O[Si](C)(C)C)C1CCCC1)C(=O)O |
| InChI | InChI=1S/C13H28N2O3Si/c1-15(13(16)17)9-11(14)12(18-19(2,3)4)10-7-5-6-8-10/h10-12H,5-9,14H2,1-4H3,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | FUNWSBWFUCVSNP-NEPJUHHUSA-N |
| XLogP | 2.33 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|