C19H23Cl2N3 — CID 68711094
1-[3-[2-(cyclohexen-1-yl)ethyl]-5-(2,4-dichlorophenyl)imidazol-4-yl]ethanamine (PubChem CID 68711094) has the molecular formula C19H23Cl2N3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 1-[3-[2-(cyclohexen-1-yl)ethyl]-5-(2,4-dichlorophenyl)imidazol-4-yl]ethanamine.
| Compound Name | 1-[3-[2-(cyclohexen-1-yl)ethyl]-5-(2,4-dichlorophenyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 68711094 |
| Molecular Formula | C19H23Cl2N3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[3-[2-(cyclohexen-1-yl)ethyl]-5-(2,4-dichlorophenyl)imidazol-4-yl]ethanamine |
| SMILES | CC(N)c1c(-c2ccc(Cl)cc2Cl)ncn1CCC1=CCCCC1 |
| InChI | InChI=1S/C19H23Cl2N3/c1-13(22)19-18(16-8-7-15(20)11-17(16)21)23-12-24(19)10-9-14-5-3-2-4-6-14/h5,7-8,11-13H,2-4,6,9-10,22H2,1H3 |
| InChIKey | GMMMRSZOJVBYFT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|