C18H19ClN6 — CID 68712079
3-piperidin-4-yl-1-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-8-amine;hydrochloride (PubChem CID 68712079) has the molecular formula C18H19ClN6 and a molecular weight of 354.85 g/mol. Its IUPAC name is 3-piperidin-4-yl-1-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-8-amine;hydrochloride.
| Compound Name | 3-piperidin-4-yl-1-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-8-amine;hydrochloride |
|---|---|
| PubChem CID | 68712079 |
| Molecular Formula | C18H19ClN6 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-piperidin-4-yl-1-(2-pyridin-3-ylethynyl)imidazo[1,5-a]pyrazin-8-amine;hydrochloride |
| SMILES | Cl.Nc1nccn2c(C3CCNCC3)nc(C#Cc3cccnc3)c12 |
| InChI | InChI=1S/C18H18N6.ClH/c19-17-16-15(4-3-13-2-1-7-21-12-13)23-18(24(16)11-10-22-17)14-5-8-20-9-6-14;/h1-2,7,10-12,14,20H,5-6,8-9H2,(H2,19,22);1H |
| InChIKey | AVYXOPPWZHPYKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|