C14H13NO6 — CID 68712616
(2S)-2-(1-benzofuran-5-carbonylamino)-3-methylbutanedioic acid (PubChem CID 68712616) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2S)-2-(1-benzofuran-5-carbonylamino)-3-methylbutanedioic acid.
| Compound Name | (2S)-2-(1-benzofuran-5-carbonylamino)-3-methylbutanedioic acid |
|---|---|
| PubChem CID | 68712616 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2S)-2-(1-benzofuran-5-carbonylamino)-3-methylbutanedioic acid |
| SMILES | CC(C(=O)O)[C@H](NC(=O)c1ccc2occc2c1)C(=O)O |
| InChI | InChI=1S/C14H13NO6/c1-7(13(17)18)11(14(19)20)15-12(16)9-2-3-10-8(6-9)4-5-21-10/h2-7,11H,1H3,(H,15,16)(H,17,18)(H,19,20)/t7?,11-/m0/s1 |
| InChIKey | HIDORHWDMXZIQS-QRIDDKLISA-N |
| XLogP | 1.34 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |