C16H32N2O5Si — CID 68713325
[1-[methyl(1-trimethylsilylethoxycarbonyl)amino]-3-[(3R)-oxan-3-yl]propan-2-yl]carbamic acid (PubChem CID 68713325) has the molecular formula C16H32N2O5Si and a molecular weight of 360.53 g/mol. Its IUPAC name is [1-[methyl(1-trimethylsilylethoxycarbonyl)amino]-3-[(3R)-oxan-3-yl]propan-2-yl]carbamic acid.
| Compound Name | [1-[methyl(1-trimethylsilylethoxycarbonyl)amino]-3-[(3R)-oxan-3-yl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68713325 |
| Molecular Formula | C16H32N2O5Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | [1-[methyl(1-trimethylsilylethoxycarbonyl)amino]-3-[(3R)-oxan-3-yl]propan-2-yl]carbamic acid |
| SMILES | CC(OC(=O)N(C)CC(C[C@H]1CCCOC1)NC(=O)O)[Si](C)(C)C |
| InChI | InChI=1S/C16H32N2O5Si/c1-12(24(3,4)5)23-16(21)18(2)10-14(17-15(19)20)9-13-7-6-8-22-11-13/h12-14,17H,6-11H2,1-5H3,(H,19,20)/t12?,13-,14?/m1/s1 |
| InChIKey | YIFUTSXSCICVLV-ROKHWSDSSA-N |
| XLogP | 2.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|