C26H33ClN3O4S+ — CID 68713411
[3-[4-(4-amino-2-oxo-1-oxaspiro[4.5]dec-3-en-3-yl)-2-chloro-5-methylphenyl]phenyl]sulfamoyl-ethyl-dimethylazanium (PubChem CID 68713411) has the molecular formula C26H33ClN3O4S+ and a molecular weight of 519.09 g/mol. Its IUPAC name is [3-[4-(4-amino-2-oxo-1-oxaspiro[4.5]dec-3-en-3-yl)-2-chloro-5-methylphenyl]phenyl]sulfamoyl-ethyl-dimethylazanium.
| Compound Name | [3-[4-(4-amino-2-oxo-1-oxaspiro[4.5]dec-3-en-3-yl)-2-chloro-5-methylphenyl]phenyl]sulfamoyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 68713411 |
| Molecular Formula | C26H33ClN3O4S+ |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [3-[4-(4-amino-2-oxo-1-oxaspiro[4.5]dec-3-en-3-yl)-2-chloro-5-methylphenyl]phenyl]sulfamoyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)S(=O)(=O)Nc1cccc(-c2cc(C)c(C3=C(N)C4(CCCCC4)OC3=O)cc2Cl)c1 |
| InChI | InChI=1S/C26H32ClN3O4S/c1-5-30(3,4)35(32,33)29-19-11-9-10-18(15-19)21-14-17(2)20(16-22(21)27)23-24(28)26(34-25(23)31)12-7-6-8-13-26/h9-11,14-16,29H,5-8,12-13H2,1-4H3,(H-,28,31)/p+1 |
| InChIKey | AZCBBKHBKZVWRV-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|