C22H23ClN2O2 — CID 90976968
3-[4-(3-aminophenyl)-5-chloro-2-methylphenyl]-4-imino-1-oxaspiro[4.5]decan-2-one (PubChem CID 90976968) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 3-[4-(3-aminophenyl)-5-chloro-2-methylphenyl]-4-imino-1-oxaspiro[4.5]decan-2-one.
| Compound Name | 3-[4-(3-aminophenyl)-5-chloro-2-methylphenyl]-4-imino-1-oxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 90976968 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-[4-(3-aminophenyl)-5-chloro-2-methylphenyl]-4-imino-1-oxaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\C(c2cc(Cl)c(-c3cccc(N)c3)cc2C)C(=O)OC12CCCCC2 |
| InChI | InChI=1S/C22H23ClN2O2/c1-13-10-17(14-6-5-7-15(24)11-14)18(23)12-16(13)19-20(25)22(27-21(19)26)8-3-2-4-9-22/h5-7,10-12,19,25H,2-4,8-9,24H2,1H3/b25-20+ |
| InChIKey | YTGLSRCLJADFML-LKUDQCMESA-N |
| XLogP | 5.26 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|