C30H28ClNO6S — CID 90936853
3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-9-phenacyl-1-oxa-9-azaspiro[4.5]decane-2,4-dione (PubChem CID 90936853) has the molecular formula C30H28ClNO6S and a molecular weight of 566.08 g/mol. Its IUPAC name is 3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-9-phenacyl-1-oxa-9-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-9-phenacyl-1-oxa-9-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 90936853 |
| Molecular Formula | C30H28ClNO6S |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | 3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-9-phenacyl-1-oxa-9-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(-c2cccc(S(C)(=O)=O)c2)c(Cl)cc1C1C(=O)OC2(CCCN(CC(=O)c3ccccc3)C2)C1=O |
| InChI | InChI=1S/C30H28ClNO6S/c1-19-14-24(21-10-6-11-22(15-21)39(2,36)37)25(31)16-23(19)27-28(34)30(38-29(27)35)12-7-13-32(18-30)17-26(33)20-8-4-3-5-9-20/h3-6,8-11,14-16,27H,7,12-13,17-18H2,1-2H3 |
| InChIKey | XGVIPMJPAAIHIQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|