C30H28ClN3O5S — CID 91494752
9-(1H-benzimidazol-2-ylmethyl)-3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-1-oxa-9-azaspiro[4.5]decane-2,4-dione (PubChem CID 91494752) has the molecular formula C30H28ClN3O5S and a molecular weight of 578.09 g/mol. Its IUPAC name is 9-(1H-benzimidazol-2-ylmethyl)-3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-1-oxa-9-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-(1H-benzimidazol-2-ylmethyl)-3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-1-oxa-9-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91494752 |
| Molecular Formula | C30H28ClN3O5S |
| Molecular Weight | 578.09 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | 9-(1H-benzimidazol-2-ylmethyl)-3-[5-chloro-2-methyl-4-(3-methylsulfonylphenyl)phenyl]-1-oxa-9-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(-c2cccc(S(C)(=O)=O)c2)c(Cl)cc1C1C(=O)OC2(CCCN(Cc3nc4ccccc4[nH]3)C2)C1=O |
| InChI | InChI=1S/C30H28ClN3O5S/c1-18-13-22(19-7-5-8-20(14-19)40(2,37)38)23(31)15-21(18)27-28(35)30(39-29(27)36)11-6-12-34(17-30)16-26-32-24-9-3-4-10-25(24)33-26/h3-5,7-10,13-15,27H,6,11-12,16-17H2,1-2H3,(H,32,33) |
| InChIKey | VBQSJEAJONBKRX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.09 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|