C25H26ClNO4 — CID 91579459
N-[5-[2-chloro-4-(2,4-dioxo-1-oxaspiro[4.5]decan-3-yl)-5-methylphenyl]-2-methylphenyl]acetamide (PubChem CID 91579459) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is N-[5-[2-chloro-4-(2,4-dioxo-1-oxaspiro[4.5]decan-3-yl)-5-methylphenyl]-2-methylphenyl]acetamide.
| Compound Name | N-[5-[2-chloro-4-(2,4-dioxo-1-oxaspiro[4.5]decan-3-yl)-5-methylphenyl]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 91579459 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[5-[2-chloro-4-(2,4-dioxo-1-oxaspiro[4.5]decan-3-yl)-5-methylphenyl]-2-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2cc(C)c(C3C(=O)OC4(CCCCC4)C3=O)cc2Cl)ccc1C |
| InChI | InChI=1S/C25H26ClNO4/c1-14-7-8-17(12-21(14)27-16(3)28)19-11-15(2)18(13-20(19)26)22-23(29)25(31-24(22)30)9-5-4-6-10-25/h7-8,11-13,22H,4-6,9-10H2,1-3H3,(H,27,28) |
| InChIKey | VUNHDYXYBWNHNH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|