C19H20BrClO3 — CID 91143295
3'-(4-bromo-5-chloro-2-methylphenyl)spiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-oxolane]-2',4'-dione (PubChem CID 91143295) has the molecular formula C19H20BrClO3 and a molecular weight of 411.72 g/mol. Its IUPAC name is 3'-(4-bromo-5-chloro-2-methylphenyl)spiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-oxolane]-2',4'-dione.
| Compound Name | 3'-(4-bromo-5-chloro-2-methylphenyl)spiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-oxolane]-2',4'-dione |
|---|---|
| PubChem CID | 91143295 |
| Molecular Formula | C19H20BrClO3 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 3'-(4-bromo-5-chloro-2-methylphenyl)spiro[1,2,3,3a,4,5,7,7a-octahydroindene-6,5'-oxolane]-2',4'-dione |
| SMILES | Cc1cc(Br)c(Cl)cc1C1C(=O)OC2(CCC3CCCC3C2)C1=O |
| InChI | InChI=1S/C19H20BrClO3/c1-10-7-14(20)15(21)8-13(10)16-17(22)19(24-18(16)23)6-5-11-3-2-4-12(11)9-19/h7-8,11-12,16H,2-6,9H2,1H3 |
| InChIKey | UKKGRDJLPNOALT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|