C17H18Cl2O4 — CID 91192432
3-(2,3-dichloro-6-methylphenyl)-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione (PubChem CID 91192432) has the molecular formula C17H18Cl2O4 and a molecular weight of 357.23 g/mol. Its IUPAC name is 3-(2,3-dichloro-6-methylphenyl)-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2,3-dichloro-6-methylphenyl)-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91192432 |
| Molecular Formula | C17H18Cl2O4 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-(2,3-dichloro-6-methylphenyl)-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione |
| SMILES | COC1CCC2(CC1)OC(=O)C(c1c(C)ccc(Cl)c1Cl)C2=O |
| InChI | InChI=1S/C17H18Cl2O4/c1-9-3-4-11(18)14(19)12(9)13-15(20)17(23-16(13)21)7-5-10(22-2)6-8-17/h3-4,10,13H,5-8H2,1-2H3 |
| InChIKey | BRUWOMNLMZVAOF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|