C25H25F3O4 — CID 91026722
3-[2,5-dimethyl-4-[3-(trifluoromethyl)phenyl]phenyl]-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione (PubChem CID 91026722) has the molecular formula C25H25F3O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is 3-[2,5-dimethyl-4-[3-(trifluoromethyl)phenyl]phenyl]-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2,5-dimethyl-4-[3-(trifluoromethyl)phenyl]phenyl]-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91026722 |
| Molecular Formula | C25H25F3O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 3-[2,5-dimethyl-4-[3-(trifluoromethyl)phenyl]phenyl]-8-methoxy-1-oxaspiro[4.5]decane-2,4-dione |
| SMILES | COC1CCC2(CC1)OC(=O)C(c1cc(C)c(-c3cccc(C(F)(F)F)c3)cc1C)C2=O |
| InChI | InChI=1S/C25H25F3O4/c1-14-12-20(15(2)11-19(14)16-5-4-6-17(13-16)25(26,27)28)21-22(29)24(32-23(21)30)9-7-18(31-3)8-10-24/h4-6,11-13,18,21H,7-10H2,1-3H3 |
| InChIKey | CXVBYCSOVDUVNB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|