C18H21ClO6S — CID 18684687
[3-(2-chloro-4-methylphenyl)-8-methoxy-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] methanesulfonate (PubChem CID 18684687) has the molecular formula C18H21ClO6S and a molecular weight of 400.88 g/mol. Its IUPAC name is [3-(2-chloro-4-methylphenyl)-8-methoxy-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] methanesulfonate.
| Compound Name | [3-(2-chloro-4-methylphenyl)-8-methoxy-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 18684687 |
| Molecular Formula | C18H21ClO6S |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | [3-(2-chloro-4-methylphenyl)-8-methoxy-2-oxo-1-oxaspiro[4.5]dec-3-en-4-yl] methanesulfonate |
| SMILES | COC1CCC2(CC1)OC(=O)C(c1ccc(C)cc1Cl)=C2OS(C)(=O)=O |
| InChI | InChI=1S/C18H21ClO6S/c1-11-4-5-13(14(19)10-11)15-16(25-26(3,21)22)18(24-17(15)20)8-6-12(23-2)7-9-18/h4-5,10,12H,6-9H2,1-3H3 |
| InChIKey | AUSCXCDVZXMCRO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|